Format:Infocaseta Medicament

De la Wikipedia, enciclopedia liberă
Jump to navigation Jump to search

Documentație format
Această documentație este adusă de la pagina Format:Infocaseta Medicament/doc.


Infocaseta Medicament oferă o trecere în revistă a celor mai des căutate informații despre un medicament, într-o casetă laterală de adăugat la articolul propriu-zis. Infocaseta este utilă pentru toate medicamentele și ar trebui să ofere și detalii legate de farmacocinetică, farmacodinamie și date clinice.


{{Infocaseta Medicament
|IUPAC          = 
|imagine        = 
|descriere      = 
|imagine2       = 
|descriere2     = 
|imagine3       = 
|alte denumiri  = 
|denumiri comerciale  = 
|CAS            = 
|ATC            = 
|smiles         = 
|inchi          =
|statut legal   =
|administrare   =
|metabolism     =
|biodisponibilitate =
|timp de înjumătățire =
|doză letală    =
|doză minimă letală =
|doză letală medie =
|excreție       = 
|formulă        = 
|masă molară    = 
|densitate      = 
|stare de agregare = 
|punct de topire = 
|punct de fierbere = 
|solubilitate în apă = 
|solubilitate =
|hazard         = {{hazard}}
|SGH            = {{SGH|SGH|SGH}}
|NFPA_S         =
|NFPA_I         =
|NFPA_R         =
|NFPA_A         =
|R              = {{Frază R|}}
|S              = {{Frază S|}}


Infocaseta Medicament
Nume IUPACacid 2-(acetoxi)benzoic
Număr CAS50-78-2
Date chimice
Masă molară180,157 g/mol
Date fizice
Densitate1,40 g/cm3
Punct de topire135 °C
Punct de fierbere140 °C
{{Infocaseta Medicament
|nume           = Aspirină
|IUPAC          = acid 2-(acetoxi)benzoic
|imagine        = Aspirin-skeletal.svg
|descriere      = 
|imagine2       = Aspirin-B-3D-balls.png
|descriere2     = 
|imagine3       = 
|alte denumiri  = Acid acetilsalicilic
|CAS            = 50-78-2 
|smiles         = O=C(Oc1ccccc1C(=O)O)C
|inchi          = InChI=1S/C9H8O4/c1-6(10)13-8-5-3-2-4-7(8)9(11)12/h2-5H,1H3,(H,11,12)
|formulă        = C<sub>9</sub>H<sub>8</sub>O<sub>4</sub>
|masă molară    = 180,157 g/mol
|densitate      = 1,40 g/cm<sup>3</sup>
|stare de agregare = 
|punct de topire = 135 °C
|punct de fierbere = 140 °C
|solubilitate în apă = 3 mg/mL (20 °C)
|solubilitate =
|R={{frază R|22|36/37/38}}
|NFPA_S         =
|NFPA_I         =
|NFPA_R         =
|NFPA_A         =
|S              = {{Frază S|}}