Format:Infocaseta Medicament

De la Wikipedia, enciclopedia liberă
Salt la: Navigare, căutare
Infocaseta Medicament
Nume comun
Număr CAS
Cod ATC
Statut legal
Toxicomanie
(dependență)
Căi de administrare
Metabolism
Biodisponibilitate
Timp de înjumătățire
(biologic)
Mod de excreție
Doza letală
Doza minimă letală
Doza letală medie
Formulă chimică
Masă molară
Densitate
Punct de topire
Punct de fierbere
Solubilitate
în apă
Solubilitate
Fraze R
Fraze S
Sunt folosite unitățile SI și condițiile de temperatură și presiune normale dacă nu s-a specificat altfel.
Documentație
Documentație format
Această documentație este adusă de la pagina Format:Infocaseta Medicament/doc.

Scop

Infocaseta Medicament oferă o trecere în revistă a celor mai des căutate informații despre o substanță, într-o casetă laterală de adăugat la articolul propriu-zis. Infocaseta este utilă pentru toate medicamentele, oferind și detalii farmacocinetice și clinice.

Utilizare

{{Infocaseta Medicament
|IUPAC          = 
|imagine        = 
|descriere      = 
|imagine2       = 
|descriere2     = 
|imagine3       = 
|alte denumiri  = 
|denumiri comerciale  = 
|CAS            = 
|ATC            = 
|smiles         = 
|inchi          =
|statut legal   =
|administrare   =
|metabolism     =
|biodisponibilitate =
|timp de înjumătățire =
|doză letală    =
|doză minimă letală =
|doză letală medie =
|excreție       = 
|formulă        = 
|masă molară    = 
|densitate      = 
|stare de agregare = 
|punct de topire = 
|punct de fierbere = 
|solubilitate în apă = 
|solubilitate =
|hazard         = {{hazard}}
|SGH            = {{SGH|SGH|SGH}}
|NFPA_S         =
|NFPA_I         =
|NFPA_R         =
|NFPA_A         =
|R              = {{Frază R|}}
|S              = {{Frază S|}}
}}

Exemplu

Aspirină
Aspirin-skeletal.svg
Aspirin-B-3D-balls.png
Denumiri
Nume comun Aspirină
Nume IUPAC
acid 2-(acetoxi)benzoic
Alte denumiri
Acid acetilsalicilic
Identificare
Număr CAS 50-78-2
Cod ATC
Statut legal
Toxicomanie
(dependență)
Căi de administrare
Metabolism
Biodisponibilitate
Timp de înjumătățire
(biologic)
Mod de excreție
Doza letală
Doza minimă letală
Doza letală medie
Date chimice
Formulă chimică C9H8O4
Masă molară 180,157 g/mol
Date fizice
Densitate 1,40 g/cm3
Punct de topire 135 °C
Punct de fierbere 140 °C
Solubilitate
în apă
3 mg/mL (20 °C)
Solubilitate
Fraze R
Fraze S
Sunt folosite unitățile SI și condițiile de temperatură și presiune normale dacă nu s-a specificat altfel.
{{Infocaseta Medicament
|nume           = Aspirină
|IUPAC          = acid 2-(acetoxi)benzoic
|imagine        = Aspirin-skeletal.svg
|descriere      = 
|imagine2       = Aspirin-B-3D-balls.png
|descriere2     = 
|imagine3       = 
|alte denumiri  = Acid acetilsalicilic
|CAS            = 50-78-2 
|smiles         = O=C(Oc1ccccc1C(=O)O)C
|inchi          = InChI=1S/C9H8O4/c1-6(10)13-8-5-3-2-4-7(8)9(11)12/h2-5H,1H3,(H,11,12)
|formulă        = C<sub>9</sub>H<sub>8</sub>O<sub>4</sub>
|masă molară    = 180,157 g/mol
|densitate      = 1,40 g/cm<sup>3</sup>
|stare de agregare = 
|punct de topire = 135 °C
|punct de fierbere = 140 °C
|solubilitate în apă = 3 mg/mL (20 °C)
|solubilitate =
|hazard         = {{hazard}}
|SGH            = {{SGH|SGH|SGH}}
|NFPA_S         =
|NFPA_I         =
|NFPA_R         =
|NFPA_A         =
|R              = {{Frază R|}}
|S              = {{Frază S|}}
}}